C16H15N5O2 — CID 118178138
ethyl 5-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,8,10,13,15-heptaene-9-carboxylate (PubChem CID 118178138) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is ethyl 5-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,8,10,13,15-heptaene-9-carboxylate.
| Compound Name | ethyl 5-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,8,10,13,15-heptaene-9-carboxylate |
|---|---|
| PubChem CID | 118178138 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | ethyl 5-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,8,10,13,15-heptaene-9-carboxylate |
| SMILES | CCOC(=O)c1ncn2c1Cc1c(C)nnn1-c1ccccc1-2 |
| InChI | InChI=1S/C16H15N5O2/c1-3-23-16(22)15-14-8-13-10(2)18-19-21(13)12-7-5-4-6-11(12)20(14)9-17-15/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | ZVCVXDDXZIGLCU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |