C17H13FO2S — CID 11324042
2-fluoro-6-(4-methylphenyl)sulfonylnaphthalene (PubChem CID 11324042) has the molecular formula C17H13FO2S and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-fluoro-6-(4-methylphenyl)sulfonylnaphthalene.
| Compound Name | 2-fluoro-6-(4-methylphenyl)sulfonylnaphthalene |
|---|---|
| PubChem CID | 11324042 |
| Molecular Formula | C17H13FO2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-fluoro-6-(4-methylphenyl)sulfonylnaphthalene |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc3cc(F)ccc3c2)cc1 |
| InChI | InChI=1S/C17H13FO2S/c1-12-2-7-16(8-3-12)21(19,20)17-9-5-13-10-15(18)6-4-14(13)11-17/h2-11H,1H3 |
| InChIKey | JEUCCMUXVGEGDT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |