C20H16F2N2O2S — CID 9461340
N-[(Z)-(2,4-difluorophenyl)methylideneamino]-4-(4-methylphenyl)sulfonylaniline (PubChem CID 9461340) has the molecular formula C20H16F2N2O2S and a molecular weight of 386.42 g/mol. Its IUPAC name is N-[(Z)-(2,4-difluorophenyl)methylideneamino]-4-(4-methylphenyl)sulfonylaniline.
| Compound Name | N-[(Z)-(2,4-difluorophenyl)methylideneamino]-4-(4-methylphenyl)sulfonylaniline |
|---|---|
| PubChem CID | 9461340 |
| Molecular Formula | C20H16F2N2O2S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[(Z)-(2,4-difluorophenyl)methylideneamino]-4-(4-methylphenyl)sulfonylaniline |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(N/N=C\c3ccc(F)cc3F)cc2)cc1 |
| InChI | InChI=1S/C20H16F2N2O2S/c1-14-2-8-18(9-3-14)27(25,26)19-10-6-17(7-11-19)24-23-13-15-4-5-16(21)12-20(15)22/h2-13,24H,1H3/b23-13- |
| InChIKey | MIYOGRUGBIBALV-QRVIBDJDSA-N |
| XLogP | 4.55 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|