C24H19F3N2O2S — CID 118855476
3-(4-methylphenyl)-1-(4-methylsulfonylphenyl)-5-[4-(trifluoromethyl)phenyl]pyrazole (PubChem CID 118855476) has the molecular formula C24H19F3N2O2S and a molecular weight of 456.49 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1-(4-methylsulfonylphenyl)-5-[4-(trifluoromethyl)phenyl]pyrazole.
| Compound Name | 3-(4-methylphenyl)-1-(4-methylsulfonylphenyl)-5-[4-(trifluoromethyl)phenyl]pyrazole |
|---|---|
| PubChem CID | 118855476 |
| Molecular Formula | C24H19F3N2O2S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 3-(4-methylphenyl)-1-(4-methylsulfonylphenyl)-5-[4-(trifluoromethyl)phenyl]pyrazole |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)n(-c3ccc(S(C)(=O)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C24H19F3N2O2S/c1-16-3-5-17(6-4-16)22-15-23(18-7-9-19(10-8-18)24(25,26)27)29(28-22)20-11-13-21(14-12-20)32(2,30)31/h3-15H,1-2H3 |
| InChIKey | GZJPQZRHMDJSMM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |