C19H15F3N2O4S — CID 22909681
[4-[5-(4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl] acetate (PubChem CID 22909681) has the molecular formula C19H15F3N2O4S and a molecular weight of 424.40 g/mol. Its IUPAC name is [4-[5-(4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl] acetate.
| Compound Name | [4-[5-(4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 22909681 |
| Molecular Formula | C19H15F3N2O4S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | [4-[5-(4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H15F3N2O4S/c1-12(25)28-15-7-5-14(6-8-15)24-17(11-18(23-24)19(20,21)22)13-3-9-16(10-4-13)29(2,26)27/h3-11H,1-2H3 |
| InChIKey | USRGKGAQEIACLT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|