C25H19F3N4O7S — CID 86603874
[4-(nitrooxymethyl)phenyl] N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamate (PubChem CID 86603874) has the molecular formula C25H19F3N4O7S and a molecular weight of 576.51 g/mol. Its IUPAC name is [4-(nitrooxymethyl)phenyl] N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamate.
| Compound Name | [4-(nitrooxymethyl)phenyl] N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 86603874 |
| Molecular Formula | C25H19F3N4O7S |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | [4-(nitrooxymethyl)phenyl] N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamate |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)NC(=O)Oc3ccc(CO[N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C25H19F3N4O7S/c1-16-2-6-18(7-3-16)22-14-23(25(26,27)28)29-31(22)19-8-12-21(13-9-19)40(36,37)30-24(33)39-20-10-4-17(5-11-20)15-38-32(34)35/h2-14H,15H2,1H3,(H,30,33) |
| InChIKey | KCVOPONTLKNQJQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|