C25H20F3N4NaO6S — CID 173240578
sodium;hydride;[4-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamoyl]phenyl]methyl nitrate (PubChem CID 173240578) has the molecular formula C25H20F3N4NaO6S and a molecular weight of 584.51 g/mol. Its IUPAC name is sodium;hydride;[4-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamoyl]phenyl]methyl nitrate.
| Compound Name | sodium;hydride;[4-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamoyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 173240578 |
| Molecular Formula | C25H20F3N4NaO6S |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | sodium;hydride;[4-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamoyl]phenyl]methyl nitrate |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)NC(=O)c3ccc(CO[N+](=O)[O-])cc3)cc2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C25H19F3N4O6S.Na.H/c1-16-2-6-18(7-3-16)22-14-23(25(26,27)28)29-31(22)20-10-12-21(13-11-20)39(36,37)30-24(33)19-8-4-17(5-9-19)15-38-32(34)35;;/h2-14H,15H2,1H3,(H,30,33);;/q;+1;-1 |
| InChIKey | ZFLBFMSLAOABOD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|