C20H18F3N3O5S — CID 24754915
(2R)-2-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]oxypropanoic acid (PubChem CID 24754915) has the molecular formula C20H18F3N3O5S and a molecular weight of 469.44 g/mol. Its IUPAC name is (2R)-2-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]oxypropanoic acid.
| Compound Name | (2R)-2-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]oxypropanoic acid |
|---|---|
| PubChem CID | 24754915 |
| Molecular Formula | C20H18F3N3O5S |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | (2R)-2-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]oxypropanoic acid |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)NO[C@H](C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H18F3N3O5S/c1-12-3-5-14(6-4-12)17-11-18(20(21,22)23)24-26(17)15-7-9-16(10-8-15)32(29,30)25-31-13(2)19(27)28/h3-11,13,25H,1-2H3,(H,27,28)/t13-/m1/s1 |
| InChIKey | WIENENPMVANVOX-CYBMUJFWSA-N |
| XLogP | 3.55 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|