C22H21BrF3N3O4S — CID 58612402
4-bromobutyl N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamate (PubChem CID 58612402) has the molecular formula C22H21BrF3N3O4S and a molecular weight of 560.39 g/mol. Its IUPAC name is 4-bromobutyl N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamate.
| Compound Name | 4-bromobutyl N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 58612402 |
| Molecular Formula | C22H21BrF3N3O4S |
| Molecular Weight | 560.39 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | 4-bromobutyl N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylcarbamate |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)NC(=O)OCCCCBr)cc2)cc1 |
| InChI | InChI=1S/C22H21BrF3N3O4S/c1-15-4-6-16(7-5-15)19-14-20(22(24,25)26)27-29(19)17-8-10-18(11-9-17)34(31,32)28-21(30)33-13-3-2-12-23/h4-11,14H,2-3,12-13H2,1H3,(H,28,30) |
| InChIKey | UFYFGPDXMJSPCE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|