C19H15F3N4O5S — CID 10389876
N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonyl-2-nitroacetamide (PubChem CID 10389876) has the molecular formula C19H15F3N4O5S and a molecular weight of 468.41 g/mol. Its IUPAC name is N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonyl-2-nitroacetamide.
| Compound Name | N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonyl-2-nitroacetamide |
|---|---|
| PubChem CID | 10389876 |
| Molecular Formula | C19H15F3N4O5S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonyl-2-nitroacetamide |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)NC(=O)C[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H15F3N4O5S/c1-12-2-4-13(5-3-12)16-10-17(19(20,21)22)23-26(16)14-6-8-15(9-7-14)32(30,31)24-18(27)11-25(28)29/h2-10H,11H2,1H3,(H,24,27) |
| InChIKey | ULKDCNWLVQFDJP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|