C23H21F3N4O7S2 — CID 71572309
2-[[(E)-4-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]-4-oxobut-2-enoyl]amino]ethanesulfonic acid (PubChem CID 71572309) has the molecular formula C23H21F3N4O7S2 and a molecular weight of 586.57 g/mol. Its IUPAC name is 2-[[(E)-4-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]-4-oxobut-2-enoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(E)-4-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]-4-oxobut-2-enoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 71572309 |
| Molecular Formula | C23H21F3N4O7S2 |
| Molecular Weight | 586.57 g/mol |
| Exact Mass | 586.08 |
| IUPAC Name | 2-[[(E)-4-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]-4-oxobut-2-enoyl]amino]ethanesulfonic acid |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)NC(=O)/C=C/C(=O)NCCS(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H21F3N4O7S2/c1-15-2-4-16(5-3-15)19-14-20(23(24,25)26)28-30(19)17-6-8-18(9-7-17)39(36,37)29-22(32)11-10-21(31)27-12-13-38(33,34)35/h2-11,14H,12-13H2,1H3,(H,27,31)(H,29,32)(H,33,34,35)/b11-10+ |
| InChIKey | CGTZMJKYAHTFSU-ZHACJKMWSA-N |
| XLogP | 2.23 |
| TPSA | 164.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.57 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|