C19H20F3N3O3S — CID 142958737
methanesulfonamide;5-(4-methoxyphenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazole (PubChem CID 142958737) has the molecular formula C19H20F3N3O3S and a molecular weight of 427.45 g/mol. Its IUPAC name is methanesulfonamide;5-(4-methoxyphenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazole.
| Compound Name | methanesulfonamide;5-(4-methoxyphenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 142958737 |
| Molecular Formula | C19H20F3N3O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | methanesulfonamide;5-(4-methoxyphenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazole |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(C)cc2)cc1.CS(N)(=O)=O |
| InChI | InChI=1S/C18H15F3N2O.CH5NO2S/c1-12-3-7-14(8-4-12)23-16(11-17(22-23)18(19,20)21)13-5-9-15(24-2)10-6-13;1-5(2,3)4/h3-11H,1-2H3;1H3,(H2,2,3,4) |
| InChIKey | POYLJYCOKQMWPT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |