C20H18F3N3O4 — CID 58806632
2-amino-3-[4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]propanoic acid (PubChem CID 58806632) has the molecular formula C20H18F3N3O4 and a molecular weight of 421.38 g/mol. Its IUPAC name is 2-amino-3-[4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]propanoic acid.
| Compound Name | 2-amino-3-[4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 58806632 |
| Molecular Formula | C20H18F3N3O4 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-amino-3-[4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]propanoic acid |
| SMILES | COc1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(OCC(N)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H18F3N3O4/c1-29-14-8-4-13(5-9-14)26-17(10-18(25-26)20(21,22)23)12-2-6-15(7-3-12)30-11-16(24)19(27)28/h2-10,16H,11,24H2,1H3,(H,27,28) |
| InChIKey | BVEAIYPQNZZCMQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |