C17H15F3N4O3S — CID 57334325
5-(4-methoxyphenyl)-1-[4-(sulfamoylamino)phenyl]-3-(trifluoromethyl)pyrazole (PubChem CID 57334325) has the molecular formula C17H15F3N4O3S and a molecular weight of 412.39 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1-[4-(sulfamoylamino)phenyl]-3-(trifluoromethyl)pyrazole.
| Compound Name | 5-(4-methoxyphenyl)-1-[4-(sulfamoylamino)phenyl]-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 57334325 |
| Molecular Formula | C17H15F3N4O3S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 5-(4-methoxyphenyl)-1-[4-(sulfamoylamino)phenyl]-3-(trifluoromethyl)pyrazole |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(NS(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H15F3N4O3S/c1-27-14-8-2-11(3-9-14)15-10-16(17(18,19)20)22-24(15)13-6-4-12(5-7-13)23-28(21,25)26/h2-10,23H,1H3,(H2,21,25,26) |
| InChIKey | JPQKOTQHESRDCU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |