C20H21ClF3N3O2 — CID 158524383
2-[4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]-N-methylethanamine;hydrochloride (PubChem CID 158524383) has the molecular formula C20H21ClF3N3O2 and a molecular weight of 427.85 g/mol. Its IUPAC name is 2-[4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]-N-methylethanamine;hydrochloride.
| Compound Name | 2-[4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]-N-methylethanamine;hydrochloride |
|---|---|
| PubChem CID | 158524383 |
| Molecular Formula | C20H21ClF3N3O2 |
| Molecular Weight | 427.85 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-[4-[1-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenoxy]-N-methylethanamine;hydrochloride |
| SMILES | CNCCOc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(OC)cc2)cc1.Cl |
| InChI | InChI=1S/C20H20F3N3O2.ClH/c1-24-11-12-28-17-7-3-14(4-8-17)18-13-19(20(21,22)23)25-26(18)15-5-9-16(27-2)10-6-15;/h3-10,13,24H,11-12H2,1-2H3;1H |
| InChIKey | ZNWAOUISUJZGFH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|