C18H17ClF3N3O — CID 21090957
[4-[5-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]methanamine;hydrochloride (PubChem CID 21090957) has the molecular formula C18H17ClF3N3O and a molecular weight of 383.80 g/mol. Its IUPAC name is [4-[5-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]methanamine;hydrochloride.
| Compound Name | [4-[5-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 21090957 |
| Molecular Formula | C18H17ClF3N3O |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [4-[5-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]methanamine;hydrochloride |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(CN)cc2)cc1.Cl |
| InChI | InChI=1S/C18H16F3N3O.ClH/c1-25-15-8-4-13(5-9-15)16-10-17(18(19,20)21)23-24(16)14-6-2-12(11-22)3-7-14;/h2-10H,11,22H2,1H3;1H |
| InChIKey | XDNGZNGPUKGGJP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |