C20H24ClN3O — CID 21090936
[4-[1-(4-methoxyphenyl)-3-propan-2-ylpyrazol-5-yl]phenyl]methanamine;hydrochloride (PubChem CID 21090936) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is [4-[1-(4-methoxyphenyl)-3-propan-2-ylpyrazol-5-yl]phenyl]methanamine;hydrochloride.
| Compound Name | [4-[1-(4-methoxyphenyl)-3-propan-2-ylpyrazol-5-yl]phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 21090936 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [4-[1-(4-methoxyphenyl)-3-propan-2-ylpyrazol-5-yl]phenyl]methanamine;hydrochloride |
| SMILES | COc1ccc(-n2nc(C(C)C)cc2-c2ccc(CN)cc2)cc1.Cl |
| InChI | InChI=1S/C20H23N3O.ClH/c1-14(2)19-12-20(16-6-4-15(13-21)5-7-16)23(22-19)17-8-10-18(24-3)11-9-17;/h4-12,14H,13,21H2,1-3H3;1H |
| InChIKey | XPNJJKUAIJKABG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |