C28H27FN2O3 — CID 14871160
ethyl 3-(4-fluorophenyl)-3-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]propanoate (PubChem CID 14871160) has the molecular formula C28H27FN2O3 and a molecular weight of 458.53 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)-3-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]propanoate.
| Compound Name | ethyl 3-(4-fluorophenyl)-3-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]propanoate |
|---|---|
| PubChem CID | 14871160 |
| Molecular Formula | C28H27FN2O3 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)-3-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]propanoate |
| SMILES | CCOC(=O)CC(c1ccc(F)cc1)c1cc(-c2ccc(C)cc2)n(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C28H27FN2O3/c1-4-34-28(32)17-25(20-9-11-22(29)12-10-20)26-18-27(21-7-5-19(2)6-8-21)31(30-26)23-13-15-24(33-3)16-14-23/h5-16,18,25H,4,17H2,1-3H3 |
| InChIKey | LYBRGXWQLJPILI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |