C21H21ClN2O3 — CID 11222871
ethyl 3-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]propanoate (PubChem CID 11222871) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is ethyl 3-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]propanoate.
| Compound Name | ethyl 3-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]propanoate |
|---|---|
| PubChem CID | 11222871 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | ethyl 3-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]propanoate |
| SMILES | CCOC(=O)CCc1cc(-c2ccc(Cl)cc2)n(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C21H21ClN2O3/c1-3-27-21(25)13-8-17-14-20(15-4-6-16(22)7-5-15)24(23-17)18-9-11-19(26-2)12-10-18/h4-7,9-12,14H,3,8,13H2,1-2H3 |
| InChIKey | CTVFCMYPYJBKEY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |