C18H15ClN2O2 — CID 14497452
3-[5-(4-chlorophenyl)-1-phenylpyrazol-3-yl]propanoic acid (PubChem CID 14497452) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1-phenylpyrazol-3-yl]propanoic acid.
| Compound Name | 3-[5-(4-chlorophenyl)-1-phenylpyrazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 14497452 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1-phenylpyrazol-3-yl]propanoic acid |
| SMILES | O=C(O)CCc1cc(-c2ccc(Cl)cc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H15ClN2O2/c19-14-8-6-13(7-9-14)17-12-15(10-11-18(22)23)20-21(17)16-4-2-1-3-5-16/h1-9,12H,10-11H2,(H,22,23) |
| InChIKey | WXVPSKFHMWDFPT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |