C18H17N3O4S — CID 10523251
1-(4-methoxyphenyl)-5-(4-methylsulfonylphenyl)pyrazole-3-carboxamide (PubChem CID 10523251) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-(4-methylsulfonylphenyl)pyrazole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-5-(4-methylsulfonylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 10523251 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-(4-methylsulfonylphenyl)pyrazole-3-carboxamide |
| SMILES | COc1ccc(-n2nc(C(N)=O)cc2-c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-25-14-7-5-13(6-8-14)21-17(11-16(20-21)18(19)22)12-3-9-15(10-4-12)26(2,23)24/h3-11H,1-2H3,(H2,19,22) |
| InChIKey | DLTNFSVADMSMJM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |