C17H17N3O4S2 — CID 19886132
4-[3-methylsulfonyl-5-(4-methylsulfonylphenyl)pyrazol-1-yl]aniline (PubChem CID 19886132) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-[3-methylsulfonyl-5-(4-methylsulfonylphenyl)pyrazol-1-yl]aniline.
| Compound Name | 4-[3-methylsulfonyl-5-(4-methylsulfonylphenyl)pyrazol-1-yl]aniline |
|---|---|
| PubChem CID | 19886132 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 4-[3-methylsulfonyl-5-(4-methylsulfonylphenyl)pyrazol-1-yl]aniline |
| SMILES | CS(=O)(=O)c1ccc(-c2cc(S(C)(=O)=O)nn2-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H17N3O4S2/c1-25(21,22)15-9-3-12(4-10-15)16-11-17(26(2,23)24)19-20(16)14-7-5-13(18)6-8-14/h3-11H,18H2,1-2H3 |
| InChIKey | PHWTUMUHUGFUOT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|