C18H15F3N2O2S — CID 18355439
3-(difluoromethyl)-1-(4-fluoro-3-methylphenyl)-5-(4-methylsulfonylphenyl)pyrazole (PubChem CID 18355439) has the molecular formula C18H15F3N2O2S and a molecular weight of 380.39 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-(4-fluoro-3-methylphenyl)-5-(4-methylsulfonylphenyl)pyrazole.
| Compound Name | 3-(difluoromethyl)-1-(4-fluoro-3-methylphenyl)-5-(4-methylsulfonylphenyl)pyrazole |
|---|---|
| PubChem CID | 18355439 |
| Molecular Formula | C18H15F3N2O2S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-(difluoromethyl)-1-(4-fluoro-3-methylphenyl)-5-(4-methylsulfonylphenyl)pyrazole |
| SMILES | Cc1cc(-n2nc(C(F)F)cc2-c2ccc(S(C)(=O)=O)cc2)ccc1F |
| InChI | InChI=1S/C18H15F3N2O2S/c1-11-9-13(5-8-15(11)19)23-17(10-16(22-23)18(20)21)12-3-6-14(7-4-12)26(2,24)25/h3-10,18H,1-2H3 |
| InChIKey | WRKSQWHEZRETRX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |