C23H18F2N2O3S — CID 67804250
4-[3-(difluoromethyl)-5-[2-(4-methylsulfonylphenyl)phenyl]pyrazol-1-yl]phenol (PubChem CID 67804250) has the molecular formula C23H18F2N2O3S and a molecular weight of 440.47 g/mol. Its IUPAC name is 4-[3-(difluoromethyl)-5-[2-(4-methylsulfonylphenyl)phenyl]pyrazol-1-yl]phenol.
| Compound Name | 4-[3-(difluoromethyl)-5-[2-(4-methylsulfonylphenyl)phenyl]pyrazol-1-yl]phenol |
|---|---|
| PubChem CID | 67804250 |
| Molecular Formula | C23H18F2N2O3S |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 4-[3-(difluoromethyl)-5-[2-(4-methylsulfonylphenyl)phenyl]pyrazol-1-yl]phenol |
| SMILES | CS(=O)(=O)c1ccc(-c2ccccc2-c2cc(C(F)F)nn2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C23H18F2N2O3S/c1-31(29,30)18-12-6-15(7-13-18)19-4-2-3-5-20(19)22-14-21(23(24)25)26-27(22)16-8-10-17(28)11-9-16/h2-14,23,28H,1H3 |
| InChIKey | BQZFLKIJGMZOLE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |