C17H13F2N2O3S- — CID 174283623
[4-[3-(difluoromethyl)-1-(4-hydroxyphenyl)pyrazol-5-yl]phenyl]methanesulfinate (PubChem CID 174283623) has the molecular formula C17H13F2N2O3S- and a molecular weight of 363.37 g/mol. Its IUPAC name is [4-[3-(difluoromethyl)-1-(4-hydroxyphenyl)pyrazol-5-yl]phenyl]methanesulfinate.
| Compound Name | [4-[3-(difluoromethyl)-1-(4-hydroxyphenyl)pyrazol-5-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174283623 |
| Molecular Formula | C17H13F2N2O3S- |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | [4-[3-(difluoromethyl)-1-(4-hydroxyphenyl)pyrazol-5-yl]phenyl]methanesulfinate |
| SMILES | O=S([O-])Cc1ccc(-c2cc(C(F)F)nn2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C17H14F2N2O3S/c18-17(19)15-9-16(12-3-1-11(2-4-12)10-25(23)24)21(20-15)13-5-7-14(22)8-6-13/h1-9,17,22H,10H2,(H,23,24)/p-1 |
| InChIKey | HEZWUHAMQXZRCO-UHFFFAOYSA-M |
| XLogP | 3.56 |
| TPSA | 78.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|