C18H18N2O5S2 — CID 102024342
[1-(4-methylsulfonylphenyl)-5-phenylpyrazol-3-yl]methyl methanesulfonate (PubChem CID 102024342) has the molecular formula C18H18N2O5S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is [1-(4-methylsulfonylphenyl)-5-phenylpyrazol-3-yl]methyl methanesulfonate.
| Compound Name | [1-(4-methylsulfonylphenyl)-5-phenylpyrazol-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 102024342 |
| Molecular Formula | C18H18N2O5S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | [1-(4-methylsulfonylphenyl)-5-phenylpyrazol-3-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cc(-c2ccccc2)n(-c2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C18H18N2O5S2/c1-26(21,22)17-10-8-16(9-11-17)20-18(14-6-4-3-5-7-14)12-15(19-20)13-25-27(2,23)24/h3-12H,13H2,1-2H3 |
| InChIKey | UBGJDFPVJGQGJQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|