C20H19F3N5O6S+ — CID 118244212
(1-acetyloxyethoxyamino)-oxo-[4-[1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]azanium (PubChem CID 118244212) has the molecular formula C20H19F3N5O6S+ and a molecular weight of 514.46 g/mol. Its IUPAC name is (1-acetyloxyethoxyamino)-oxo-[4-[1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]azanium.
| Compound Name | (1-acetyloxyethoxyamino)-oxo-[4-[1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]azanium |
|---|---|
| PubChem CID | 118244212 |
| Molecular Formula | C20H19F3N5O6S+ |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | (1-acetyloxyethoxyamino)-oxo-[4-[1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]azanium |
| SMILES | CC(=O)OC(C)ON[N+](=O)c1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H19F3N5O6S/c1-12(29)33-13(2)34-26-28(30)16-5-3-14(4-6-16)18-11-19(20(21,22)23)25-27(18)15-7-9-17(10-8-15)35(24,31)32/h3-11,13H,1-2H3,(H,26,30)(H2,24,31,32)/q+1 |
| InChIKey | PEKKZEJXBXXVHI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 145.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|