C13H9ClF3NO2S — CID 86192063
3-chloro-2-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)pyridine (PubChem CID 86192063) has the molecular formula C13H9ClF3NO2S and a molecular weight of 335.73 g/mol. Its IUPAC name is 3-chloro-2-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 86192063 |
| Molecular Formula | C13H9ClF3NO2S |
| Molecular Weight | 335.73 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 3-chloro-2-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)pyridine |
| SMILES | Cc1ccc(S(=O)(=O)c2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C13H9ClF3NO2S/c1-8-2-4-10(5-3-8)21(19,20)12-11(14)6-9(7-18-12)13(15,16)17/h2-7H,1H3 |
| InChIKey | YQFVIRWNDOEWEX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.73 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |