C14H13ClF3N3O2S — CID 8523482
N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,5-dimethylbenzenesulfonohydrazide (PubChem CID 8523482) has the molecular formula C14H13ClF3N3O2S and a molecular weight of 379.79 g/mol. Its IUPAC name is N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,5-dimethylbenzenesulfonohydrazide.
| Compound Name | N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,5-dimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 8523482 |
| Molecular Formula | C14H13ClF3N3O2S |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,5-dimethylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NNc2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C14H13ClF3N3O2S/c1-8-3-4-9(2)12(5-8)24(22,23)21-20-13-11(15)6-10(7-19-13)14(16,17)18/h3-7,21H,1-2H3,(H,19,20) |
| InChIKey | AFSHHTRNHWSOCM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|