C11H10Cl2F3N5O2S — CID 1476252
5-chloro-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1,3-dimethylpyrazole-4-sulfonohydrazide (PubChem CID 1476252) has the molecular formula C11H10Cl2F3N5O2S and a molecular weight of 404.20 g/mol. Its IUPAC name is 5-chloro-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1,3-dimethylpyrazole-4-sulfonohydrazide.
| Compound Name | 5-chloro-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1,3-dimethylpyrazole-4-sulfonohydrazide |
|---|---|
| PubChem CID | 1476252 |
| Molecular Formula | C11H10Cl2F3N5O2S |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 5-chloro-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1,3-dimethylpyrazole-4-sulfonohydrazide |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)NNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H10Cl2F3N5O2S/c1-5-8(9(13)21(2)19-5)24(22,23)20-18-10-7(12)3-6(4-17-10)11(14,15)16/h3-4,20H,1-2H3,(H,17,18) |
| InChIKey | ARHULQQBFBNNDJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|