C16H10Cl2F7NO2S — CID 169370068
N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 169370068) has the molecular formula C16H10Cl2F7NO2S and a molecular weight of 484.22 g/mol. Its IUPAC name is N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169370068 |
| Molecular Formula | C16H10Cl2F7NO2S |
| Molecular Weight | 484.22 g/mol |
| Exact Mass | 482.97 |
| IUPAC Name | N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C16H10Cl2F7NO2S/c1-8-2-4-10(5-3-8)29(27,28)26-13-11(17)6-9(7-12(13)18)14(19,15(20,21)22)16(23,24)25/h2-7,26H,1H3 |
| InChIKey | GTNMXXBZECOYOT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.22 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |