C14H12Br2ClNO3S — CID 169370736
N-(2,4-dibromo-6-chloro-3-methoxyphenyl)-4-methylbenzenesulfonamide (PubChem CID 169370736) has the molecular formula C14H12Br2ClNO3S and a molecular weight of 469.58 g/mol. Its IUPAC name is N-(2,4-dibromo-6-chloro-3-methoxyphenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(2,4-dibromo-6-chloro-3-methoxyphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169370736 |
| Molecular Formula | C14H12Br2ClNO3S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 466.86 |
| IUPAC Name | N-(2,4-dibromo-6-chloro-3-methoxyphenyl)-4-methylbenzenesulfonamide |
| SMILES | COc1c(Br)cc(Cl)c(NS(=O)(=O)c2ccc(C)cc2)c1Br |
| InChI | InChI=1S/C14H12Br2ClNO3S/c1-8-3-5-9(6-4-8)22(19,20)18-13-11(17)7-10(15)14(21-2)12(13)16/h3-7,18H,1-2H3 |
| InChIKey | OEEJAPAJSXCYGM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |