C13H9Br2ClFNO2S — CID 169371289
N-(2,4-dibromo-6-chloro-3-fluorophenyl)-4-methylbenzenesulfonamide (PubChem CID 169371289) has the molecular formula C13H9Br2ClFNO2S and a molecular weight of 457.55 g/mol. Its IUPAC name is N-(2,4-dibromo-6-chloro-3-fluorophenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(2,4-dibromo-6-chloro-3-fluorophenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169371289 |
| Molecular Formula | C13H9Br2ClFNO2S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 454.84 |
| IUPAC Name | N-(2,4-dibromo-6-chloro-3-fluorophenyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2c(Cl)cc(Br)c(F)c2Br)cc1 |
| InChI | InChI=1S/C13H9Br2ClFNO2S/c1-7-2-4-8(5-3-7)21(19,20)18-13-10(16)6-9(14)12(17)11(13)15/h2-6,18H,1H3 |
| InChIKey | VPASEKXXUKUEKA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|