C14H10BrF2NO4S — CID 169373142
5-bromo-2,3-difluoro-4-[(4-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 169373142) has the molecular formula C14H10BrF2NO4S and a molecular weight of 406.20 g/mol. Its IUPAC name is 5-bromo-2,3-difluoro-4-[(4-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 5-bromo-2,3-difluoro-4-[(4-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 169373142 |
| Molecular Formula | C14H10BrF2NO4S |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | 5-bromo-2,3-difluoro-4-[(4-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2c(Br)cc(C(=O)O)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H10BrF2NO4S/c1-7-2-4-8(5-3-7)23(21,22)18-13-10(15)6-9(14(19)20)11(16)12(13)17/h2-6,18H,1H3,(H,19,20) |
| InChIKey | WTGOKMFDIVMHRC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|