C17H15F3O2S — CID 138971767
1-methyl-4-[2-[4-(trifluoromethyl)phenyl]prop-2-enylsulfonyl]benzene (PubChem CID 138971767) has the molecular formula C17H15F3O2S and a molecular weight of 340.37 g/mol. Its IUPAC name is 1-methyl-4-[2-[4-(trifluoromethyl)phenyl]prop-2-enylsulfonyl]benzene.
| Compound Name | 1-methyl-4-[2-[4-(trifluoromethyl)phenyl]prop-2-enylsulfonyl]benzene |
|---|---|
| PubChem CID | 138971767 |
| Molecular Formula | C17H15F3O2S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 1-methyl-4-[2-[4-(trifluoromethyl)phenyl]prop-2-enylsulfonyl]benzene |
| SMILES | C=C(CS(=O)(=O)c1ccc(C)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3O2S/c1-12-3-9-16(10-4-12)23(21,22)11-13(2)14-5-7-15(8-6-14)17(18,19)20/h3-10H,2,11H2,1H3 |
| InChIKey | ZAPDAPUTOYMIKU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |