C16H15F3O3S — CID 53381751
2-phenyl-1-[4-(trifluoromethyl)phenyl]sulfonylpropan-2-ol (PubChem CID 53381751) has the molecular formula C16H15F3O3S and a molecular weight of 344.35 g/mol. Its IUPAC name is 2-phenyl-1-[4-(trifluoromethyl)phenyl]sulfonylpropan-2-ol.
| Compound Name | 2-phenyl-1-[4-(trifluoromethyl)phenyl]sulfonylpropan-2-ol |
|---|---|
| PubChem CID | 53381751 |
| Molecular Formula | C16H15F3O3S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-phenyl-1-[4-(trifluoromethyl)phenyl]sulfonylpropan-2-ol |
| SMILES | CC(O)(CS(=O)(=O)c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H15F3O3S/c1-15(20,12-5-3-2-4-6-12)11-23(21,22)14-9-7-13(8-10-14)16(17,18)19/h2-10,20H,11H2,1H3 |
| InChIKey | CFMYXPOBCYGVJU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |