C20H17ClO3S — CID 1480392
2-(4-chlorophenyl)sulfonyl-1,1-diphenylethanol (PubChem CID 1480392) has the molecular formula C20H17ClO3S and a molecular weight of 372.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-1,1-diphenylethanol.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-1,1-diphenylethanol |
|---|---|
| PubChem CID | 1480392 |
| Molecular Formula | C20H17ClO3S |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-1,1-diphenylethanol |
| SMILES | O=S(=O)(CC(O)(c1ccccc1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClO3S/c21-18-11-13-19(14-12-18)25(23,24)15-20(22,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,22H,15H2 |
| InChIKey | SSPQOSURCMLJAT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |