C11H14F3NO2S — CID 106584831
4-[4-(trifluoromethyl)phenyl]sulfonylbutan-2-amine (PubChem CID 106584831) has the molecular formula C11H14F3NO2S and a molecular weight of 281.30 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)phenyl]sulfonylbutan-2-amine.
| Compound Name | 4-[4-(trifluoromethyl)phenyl]sulfonylbutan-2-amine |
|---|---|
| PubChem CID | 106584831 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-[4-(trifluoromethyl)phenyl]sulfonylbutan-2-amine |
| SMILES | CC(N)CCS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NO2S/c1-8(15)6-7-18(16,17)10-4-2-9(3-5-10)11(12,13)14/h2-5,8H,6-7,15H2,1H3 |
| InChIKey | ZICVLMDJSNPZTL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |