C10H11F3O3S2 — CID 165397696
1-methylsulfanyl-2-[4-(trifluoromethyl)phenyl]sulfonylethanol (PubChem CID 165397696) has the molecular formula C10H11F3O3S2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 1-methylsulfanyl-2-[4-(trifluoromethyl)phenyl]sulfonylethanol.
| Compound Name | 1-methylsulfanyl-2-[4-(trifluoromethyl)phenyl]sulfonylethanol |
|---|---|
| PubChem CID | 165397696 |
| Molecular Formula | C10H11F3O3S2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 1-methylsulfanyl-2-[4-(trifluoromethyl)phenyl]sulfonylethanol |
| SMILES | CSC(O)CS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3O3S2/c1-17-9(14)6-18(15,16)8-4-2-7(3-5-8)10(11,12)13/h2-5,9,14H,6H2,1H3 |
| InChIKey | CVKRVMSBUKUPCY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|