C13H16F3NO3S — CID 106585567
1-(cyclopropylamino)-3-[4-(trifluoromethyl)phenyl]sulfonylpropan-2-ol (PubChem CID 106585567) has the molecular formula C13H16F3NO3S and a molecular weight of 323.34 g/mol. Its IUPAC name is 1-(cyclopropylamino)-3-[4-(trifluoromethyl)phenyl]sulfonylpropan-2-ol.
| Compound Name | 1-(cyclopropylamino)-3-[4-(trifluoromethyl)phenyl]sulfonylpropan-2-ol |
|---|---|
| PubChem CID | 106585567 |
| Molecular Formula | C13H16F3NO3S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-(cyclopropylamino)-3-[4-(trifluoromethyl)phenyl]sulfonylpropan-2-ol |
| SMILES | O=S(=O)(CC(O)CNC1CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3NO3S/c14-13(15,16)9-1-5-12(6-2-9)21(19,20)8-11(18)7-17-10-3-4-10/h1-2,5-6,10-11,17-18H,3-4,7-8H2 |
| InChIKey | SHBMFEYAFZHDAW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |