C14H19F3N2 — CID 117244514
N'-cyclopentyl-1-[4-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 117244514) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N'-cyclopentyl-1-[4-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | N'-cyclopentyl-1-[4-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 117244514 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N'-cyclopentyl-1-[4-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | NC(CNC1CCCC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3N2/c15-14(16,17)11-7-5-10(6-8-11)13(18)9-19-12-3-1-2-4-12/h5-8,12-13,19H,1-4,9,18H2 |
| InChIKey | SRCCLDVGOPZTBJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |