C27H26F6N2O — CID 90669221
1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(cyclohexylamino)ethanol (PubChem CID 90669221) has the molecular formula C27H26F6N2O and a molecular weight of 508.51 g/mol. Its IUPAC name is 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(cyclohexylamino)ethanol.
| Compound Name | 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(cyclohexylamino)ethanol |
|---|---|
| PubChem CID | 90669221 |
| Molecular Formula | C27H26F6N2O |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(cyclohexylamino)ethanol |
| SMILES | OC(CNC1CCCCC1)c1cc(-c2ccc(C(F)(F)F)cc2)nc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H26F6N2O/c28-26(29,30)20-10-6-17(7-11-20)23-14-19(25(36)16-34-22-4-2-1-3-5-22)15-24(35-23)18-8-12-21(13-9-18)27(31,32)33/h6-15,22,25,34,36H,1-5,16H2 |
| InChIKey | NXPIPPMAWHRNFJ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |