C28H30F6N2O — CID 90669218
1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(heptan-4-ylamino)ethanol (PubChem CID 90669218) has the molecular formula C28H30F6N2O and a molecular weight of 524.55 g/mol. Its IUPAC name is 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(heptan-4-ylamino)ethanol.
| Compound Name | 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(heptan-4-ylamino)ethanol |
|---|---|
| PubChem CID | 90669218 |
| Molecular Formula | C28H30F6N2O |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(heptan-4-ylamino)ethanol |
| SMILES | CCCC(CCC)NCC(O)c1cc(-c2ccc(C(F)(F)F)cc2)nc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C28H30F6N2O/c1-3-5-23(6-4-2)35-17-26(37)20-15-24(18-7-11-21(12-8-18)27(29,30)31)36-25(16-20)19-9-13-22(14-10-19)28(32,33)34/h7-16,23,26,35,37H,3-6,17H2,1-2H3 |
| InChIKey | VTTDAYMUVZQRAT-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |