C22H25F6NO — CID 162098581
(1R)-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]nonan-1-ol (PubChem CID 162098581) has the molecular formula C22H25F6NO and a molecular weight of 433.44 g/mol. Its IUPAC name is (1R)-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]nonan-1-ol.
| Compound Name | (1R)-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]nonan-1-ol |
|---|---|
| PubChem CID | 162098581 |
| Molecular Formula | C22H25F6NO |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (1R)-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]nonan-1-ol |
| SMILES | CCCCCCCC[C@@H](O)c1ccc(-c2ccc(C(F)(F)F)cc2)nc1C(F)(F)F |
| InChI | InChI=1S/C22H25F6NO/c1-2-3-4-5-6-7-8-19(30)17-13-14-18(29-20(17)22(26,27)28)15-9-11-16(12-10-15)21(23,24)25/h9-14,19,30H,2-8H2,1H3/t19-/m1/s1 |
| InChIKey | QWTKGGXWOPLBGG-LJQANCHMSA-N |
| XLogP | 7.57 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|