C21H24F6N2 — CID 155055196
N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]propyl]pentan-1-amine (PubChem CID 155055196) has the molecular formula C21H24F6N2 and a molecular weight of 418.43 g/mol. Its IUPAC name is N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]propyl]pentan-1-amine.
| Compound Name | N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]propyl]pentan-1-amine |
|---|---|
| PubChem CID | 155055196 |
| Molecular Formula | C21H24F6N2 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]propyl]pentan-1-amine |
| SMILES | CCCCCNCC(C)c1ccc(-c2ccc(C(F)(F)F)cc2)nc1C(F)(F)F |
| InChI | InChI=1S/C21H24F6N2/c1-3-4-5-12-28-13-14(2)17-10-11-18(29-19(17)21(25,26)27)15-6-8-16(9-7-15)20(22,23)24/h6-11,14,28H,3-5,12-13H2,1-2H3 |
| InChIKey | UACJQQCXLYYDKU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|