C24H25F6NO — CID 90668899
1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(hexylamino)ethanol (PubChem CID 90668899) has the molecular formula C24H25F6NO and a molecular weight of 457.46 g/mol. Its IUPAC name is 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(hexylamino)ethanol.
| Compound Name | 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(hexylamino)ethanol |
|---|---|
| PubChem CID | 90668899 |
| Molecular Formula | C24H25F6NO |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(hexylamino)ethanol |
| SMILES | CCCCCCNCC(O)c1cc2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C24H25F6NO/c1-2-3-4-5-10-31-14-22(32)21-11-15-6-7-16(23(25,26)27)12-19(15)20-13-17(24(28,29)30)8-9-18(20)21/h6-9,11-13,22,31-32H,2-5,10,14H2,1H3 |
| InChIKey | WGVXWSMAEFXFRC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|