C34H45F6NO — CID 90668904
1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-4-(diheptylamino)butan-1-ol (PubChem CID 90668904) has the molecular formula C34H45F6NO and a molecular weight of 597.73 g/mol. Its IUPAC name is 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-4-(diheptylamino)butan-1-ol.
| Compound Name | 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-4-(diheptylamino)butan-1-ol |
|---|---|
| PubChem CID | 90668904 |
| Molecular Formula | C34H45F6NO |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 597.34 |
| IUPAC Name | 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-4-(diheptylamino)butan-1-ol |
| SMILES | CCCCCCCN(CCCCCCC)CCCC(O)c1cc2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C34H45F6NO/c1-3-5-7-9-11-19-41(20-12-10-8-6-4-2)21-13-14-32(42)31-22-25-15-16-26(33(35,36)37)23-29(25)30-24-27(34(38,39)40)17-18-28(30)31/h15-18,22-24,32,42H,3-14,19-21H2,1-2H3 |
| InChIKey | KFSLZBUUTJLFAK-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|