C17H10BrCl2F3O — CID 125463788
(1R)-2-bromo-1-[3,4-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethanol (PubChem CID 125463788) has the molecular formula C17H10BrCl2F3O and a molecular weight of 438.07 g/mol. Its IUPAC name is (1R)-2-bromo-1-[3,4-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethanol.
| Compound Name | (1R)-2-bromo-1-[3,4-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethanol |
|---|---|
| PubChem CID | 125463788 |
| Molecular Formula | C17H10BrCl2F3O |
| Molecular Weight | 438.07 g/mol |
| Exact Mass | 435.92 |
| IUPAC Name | (1R)-2-bromo-1-[3,4-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethanol |
| SMILES | O[C@@H](CBr)c1cc2ccc(Cl)c(Cl)c2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C17H10BrCl2F3O/c18-7-14(24)11-5-8-1-4-13(19)16(20)15(8)12-6-9(17(21,22)23)2-3-10(11)12/h1-6,14,24H,7H2/t14-/m0/s1 |
| InChIKey | ZONAHFYJOSWOPT-AWEZNQCLSA-N |
| XLogP | 6.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.07 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|