C25H29ClF3NO — CID 90668912
1-[3-chloro-6-(trifluoromethyl)phenanthren-9-yl]-2-(dibutylamino)ethanol (PubChem CID 90668912) has the molecular formula C25H29ClF3NO and a molecular weight of 451.96 g/mol. Its IUPAC name is 1-[3-chloro-6-(trifluoromethyl)phenanthren-9-yl]-2-(dibutylamino)ethanol.
| Compound Name | 1-[3-chloro-6-(trifluoromethyl)phenanthren-9-yl]-2-(dibutylamino)ethanol |
|---|---|
| PubChem CID | 90668912 |
| Molecular Formula | C25H29ClF3NO |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 1-[3-chloro-6-(trifluoromethyl)phenanthren-9-yl]-2-(dibutylamino)ethanol |
| SMILES | CCCCN(CCCC)CC(O)c1cc2ccc(Cl)cc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C25H29ClF3NO/c1-3-5-11-30(12-6-4-2)16-24(31)23-13-17-7-9-19(26)15-21(17)22-14-18(25(27,28)29)8-10-20(22)23/h7-10,13-15,24,31H,3-6,11-12,16H2,1-2H3 |
| InChIKey | SZCZHQOUBGWWQF-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|