C23H28F3NOS — CID 90669397
2-(dibutylamino)-1-[8-(trifluoromethyl)benzo[g][1]benzothiol-5-yl]ethanol (PubChem CID 90669397) has the molecular formula C23H28F3NOS and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-(dibutylamino)-1-[8-(trifluoromethyl)benzo[g][1]benzothiol-5-yl]ethanol.
| Compound Name | 2-(dibutylamino)-1-[8-(trifluoromethyl)benzo[g][1]benzothiol-5-yl]ethanol |
|---|---|
| PubChem CID | 90669397 |
| Molecular Formula | C23H28F3NOS |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-(dibutylamino)-1-[8-(trifluoromethyl)benzo[g][1]benzothiol-5-yl]ethanol |
| SMILES | CCCCN(CCCC)CC(O)c1cc2ccsc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C23H28F3NOS/c1-3-5-10-27(11-6-4-2)15-21(28)19-13-16-9-12-29-22(16)20-14-17(23(24,25)26)7-8-18(19)20/h7-9,12-14,21,28H,3-6,10-11,15H2,1-2H3 |
| InChIKey | RKIQEBAQZOIXNY-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |